pickleglocck pickleglocck

11-06-2020
Mathematics

contestada

find an angle x where sin x = cos x (I know this has been answered but I rlly don't get it..)

Respuesta :

yeetosaurus69 yeetosaurus69

11-06-2020

Answer:

45 degrees

Step-by-step explanation:

sin x=cos(90-x)

sin(45)=cos(90-45)=cos(45)

Answer Link

udhayabrol udhayabrol

26-07-2020

Answer:

The answer is 45.

sin45=cos45= 1/√2.

hope it helps u ...

Answer Link

Otras preguntas

Explain why 58 can be rounded to the nearest hundred even though there is not a digit in the hundreds place?

which number is a factor or 20 but not a multiple of 2?

Please help. What is the value of the expression when a = 3 and b = 2? 3a^3 + 2b^3A.78 B.97C.135 D.745

drew's weekly allowance is $8.00.His friend Jann' s weekly allowance is $10 Drew spends $3 a week and Jan spends $4 a week. Write two expressions to show how mu

Charlie runs at a speed of 3 yards per second. About how many miles per hour does Charlie run

what is a complex set of responses

Something that affects the structure or function of an organism is referred to as a __________.modifierrashdiseasesymptom

Something that affects the structure or function of an organism is referred to as a __________.modifierrashdiseasesymptom

Is hug a indirect object or direct?

What is the place value of the 4 in 2,345?