Delsharn Delsharn
  • 15-06-2021
  • Mathematics
contestada

What’s the perimeter of the pentagon

Whats the perimeter of the pentagon class=

Respuesta :

chetankachana
chetankachana chetankachana
  • 15-06-2021

Answer:

74 cm

Step-by-step explanation:

Perimeter Pentagon = 48 + (38 - 12)

48 + 26 = 74

74 cm

If my answer is incorrect, pls correct me!

If you like my answer and explanation, mark me as brainliest!

-Chetan K

Answer Link

Otras preguntas

Show that cos(A+45)=cos45(cosA-sinA)
What is 12 1/2% as a fraction and a decimal? __________________________________ Please, I need to know the answer! Thank you!
HELP I WILL HELP YOU IF YOU CAN ANSWER CORRECT. This quarter circle has a radius of 7 cm. What is the area of this figure? Use 3.14 for pi. Enter your answer as
one of the main ideas of 1984 is how easy it is for big brother to make Winston Smith deny what he believes. TRUE FALSE
what is the term for a functionless anatomical structure often reduced in size a that is evidence of an organism's evolutionary past?
Sketch is 4 in x 5 in. Scale factor is 2 in to 5 in to a finished poster?
What goods from the Greek mainland were traded?
I want someone explain me please
What is the answer to this geometry question ?
3. Describe the process of heat transfer by conduction. What happens to the molecules that cause the thermal energy to be transferred?