mialugardo mialugardo

16-02-2022
Mathematics

contestada

Find the exact value of expression Sin(100)cos(40)-cos(100)sin(40)

Respuesta :

MagicBoiGoku MagicBoiGoku

16-02-2022

Answer: The answer is 1/2

Answer Link

Otras preguntas

Explain why a dna molecule is called a zipper

Which action in A Raisin in the Sun most clearly shows that Mama is the head of the house? O A. She buys the house in Clybourne Park. O B. She tells Beneatha to

Litmus paper is made from water-soluble dyes which are extracted from lichens. This paper is used as an acid-base indicator. Which of these common household su

When the Civil War started, why did many northern Blacks rush to join the army?

5n+1 3n-5-------- = ---------- 8 4

Which statement BEST reflects the human experience that is represented in this excerpt?

When a molecule absorbs IR eletromagnetic energy, what are the vibrational modes affected?

Skills Lesson: StructureQuiz ActiveMWhich genre uses narrative techniques to provide a glimpse into the human experience?OOtragedyshort storylyric poemexpositor

total mass of the Syringe. Record it in the correct row of the data table. how many kilograms would it be?

Dieses Mal ist die Firma der erste und dann die Möglichkeit die ganze Zeit mit zu uns zu sprechen zu können und dann können Sie