stampys stampys

12-06-2017
Mathematics

contestada

4(5x4)-2

P.S. Does anyone have a teacher named Mrs.Backus?

Respuesta :

shawana2227 shawana2227

12-06-2017

5*4=20
4(20)-2
80-2
80-2=78
78 is the answer

Answer Link

Otras preguntas

Which of the following is the correct structure of 2-methyl-3-heptenea. CH3-CH2-C(CH3)=CH-CH2-CH2-CH3b. CH3-CH2CH=CH-CH2CH(CH3)-CH3c. CH3-CH2-CH=CH-CH-(CH3)-CH2

I need to know the answer

Scott needs to split a chunk of wood for the fire. There is a crack in the chunk. If he uses an axe it will use 200 Joules of energy. He receives 100 Joules of

which statement best describes the difference between science and philosophy? OA Philosophers study human behavior whereas scientists study the natural world. B

The 45 members of chorus are trying to re-$6000 so they can compete in a singing competition in California they have already raise $1240 write an inequality to

Why were southern representatives against high protective tariffs?

After a 80% reduction, you purchase a new washing machine on sale for $132. What was the original price of the washing machine? The original price was $

Plz help with the correct answer please

Identify the sentence type. My cat is so finicky that he never eats the food I get him; he meows and meows for something different. a. simple c. complex b. comp

Which process involves a decrease in temperature?